C9H9N3O3 — CID 2771611
9-nitro-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one (PubChem CID 2771611) has the molecular formula C9H9N3O3 and a molecular weight of 207.19 g/mol. Its IUPAC name is 9-nitro-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one.
| Compound Name | 9-nitro-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one |
|---|---|
| PubChem CID | 2771611 |
| Molecular Formula | C9H9N3O3 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 9-nitro-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one |
| SMILES | O=C1NCCNc2c1cccc2[N+](=O)[O-] |
| InChI | InChI=1S/C9H9N3O3/c13-9-6-2-1-3-7(12(14)15)8(6)10-4-5-11-9/h1-3,10H,4-5H2,(H,11,13) |
| InChIKey | ZSLHWCFNYIEQJJ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|