About 4-ethynylbenzaldehyde
4-ethynylbenzaldehyde (PubChem CID 2771645) has the molecular formula C9H6O
and a molecular weight of 130.15 g/mol. Its IUPAC name is 4-ethynylbenzaldehyde.
Molecular Properties
| Compound Name | 4-ethynylbenzaldehyde |
| PubChem CID | 2771645 |
| Molecular Formula | C9H6O |
| Molecular Weight | 130.15 g/mol |
| Exact Mass | 130.04 |
| IUPAC Name | 4-ethynylbenzaldehyde |
| SMILES | C#Cc1ccc(C=O)cc1 |
| InChI | InChI=1S/C9H6O/c1-2-8-3-5-9(7-10)6-4-8/h1,3-7H |
| InChIKey | BGMHQBQFJYJLBP-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.15 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-ethynylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethynylbenzaldehyde?
The IUPAC name of 4-ethynylbenzaldehyde (CID 2771645) is 4-ethynylbenzaldehyde.
What is the SMILES notation for 4-ethynylbenzaldehyde?
The canonical SMILES for 4-ethynylbenzaldehyde is C#Cc1ccc(C=O)cc1.
What is the InChIKey of 4-ethynylbenzaldehyde?
The InChIKey is BGMHQBQFJYJLBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6O/c1-2-8-3-5-9(7-10)6-4-8/h1,3-7H.
What are the key properties of 4-ethynylbenzaldehyde?
4-ethynylbenzaldehyde has a molecular weight of 130.15 g/mol, XLogP of 1.48, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethynylbenzaldehyde is sourced from PubChem (CID 2771645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).