C15H16N2 — CID 2771647
4-phenyl-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine (PubChem CID 2771647) has the molecular formula C15H16N2 and a molecular weight of 224.31 g/mol. Its IUPAC name is 4-phenyl-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine.
| Compound Name | 4-phenyl-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine |
|---|---|
| PubChem CID | 2771647 |
| Molecular Formula | C15H16N2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 4-phenyl-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine |
| SMILES | c1ccc(C2CCNc3ccccc3N2)cc1 |
| InChI | InChI=1S/C15H16N2/c1-2-6-12(7-3-1)13-10-11-16-14-8-4-5-9-15(14)17-13/h1-9,13,16-17H,10-11H2 |
| InChIKey | HGJZFDLYTIVNHC-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_C(2)', 'substructure': 'N/A'} |
|---|