About 1-pyridin-3-ylethanamine
1-pyridin-3-ylethanamine (PubChem CID 2771688) has the molecular formula C7H10N2
and a molecular weight of 122.17 g/mol. Its IUPAC name is 1-pyridin-3-ylethanamine.
Molecular Properties
| Compound Name | 1-pyridin-3-ylethanamine |
| PubChem CID | 2771688 |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.08 |
| IUPAC Name | 1-pyridin-3-ylethanamine |
| SMILES | CC(N)c1cccnc1 |
| InChI | InChI=1S/C7H10N2/c1-6(8)7-3-2-4-9-5-7/h2-6H,8H2,1H3 |
| InChIKey | IQVQNBXPYJGNEA-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-pyridin-3-ylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyridin-3-ylethanamine?
The IUPAC name of 1-pyridin-3-ylethanamine (CID 2771688) is 1-pyridin-3-ylethanamine.
What is the SMILES notation for 1-pyridin-3-ylethanamine?
The canonical SMILES for 1-pyridin-3-ylethanamine is CC(N)c1cccnc1.
What is the InChIKey of 1-pyridin-3-ylethanamine?
The InChIKey is IQVQNBXPYJGNEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2/c1-6(8)7-3-2-4-9-5-7/h2-6H,8H2,1H3.
What are the key properties of 1-pyridin-3-ylethanamine?
1-pyridin-3-ylethanamine has a molecular weight of 122.17 g/mol, XLogP of 1.10, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyridin-3-ylethanamine is sourced from PubChem (CID 2771688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).