C23H21BrFNO4 — CID 27716942
N-[bis(4-methoxyphenyl)methyl]-2-(4-bromo-2-fluorophenoxy)acetamide (PubChem CID 27716942) has the molecular formula C23H21BrFNO4 and a molecular weight of 474.33 g/mol. Its IUPAC name is N-[bis(4-methoxyphenyl)methyl]-2-(4-bromo-2-fluorophenoxy)acetamide.
| Compound Name | N-[bis(4-methoxyphenyl)methyl]-2-(4-bromo-2-fluorophenoxy)acetamide |
|---|---|
| PubChem CID | 27716942 |
| Molecular Formula | C23H21BrFNO4 |
| Molecular Weight | 474.33 g/mol |
| Exact Mass | 473.06 |
| IUPAC Name | N-[bis(4-methoxyphenyl)methyl]-2-(4-bromo-2-fluorophenoxy)acetamide |
| SMILES | COc1ccc(C(NC(=O)COc2ccc(Br)cc2F)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C23H21BrFNO4/c1-28-18-8-3-15(4-9-18)23(16-5-10-19(29-2)11-6-16)26-22(27)14-30-21-12-7-17(24)13-20(21)25/h3-13,23H,14H2,1-2H3,(H,26,27) |
| InChIKey | MCFKRSREYUFJQK-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.33 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |