About 5-bromopyrazine-2,3-diamine
5-bromopyrazine-2,3-diamine (PubChem CID 2771857) has the molecular formula C4H5BrN4
and a molecular weight of 189.02 g/mol. Its IUPAC name is 5-bromopyrazine-2,3-diamine.
Molecular Properties
| Compound Name | 5-bromopyrazine-2,3-diamine |
| PubChem CID | 2771857 |
| Molecular Formula | C4H5BrN4 |
| Molecular Weight | 189.02 g/mol |
| Exact Mass | 187.97 |
| IUPAC Name | 5-bromopyrazine-2,3-diamine |
| SMILES | Nc1ncc(Br)nc1N |
| InChI | InChI=1S/C4H5BrN4/c5-2-1-8-3(6)4(7)9-2/h1H,(H2,6,8)(H2,7,9) |
| InChIKey | CPYAUFLEMLTQAA-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.02 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromopyrazine-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromopyrazine-2,3-diamine?
The IUPAC name of 5-bromopyrazine-2,3-diamine (CID 2771857) is 5-bromopyrazine-2,3-diamine.
What is the SMILES notation for 5-bromopyrazine-2,3-diamine?
The canonical SMILES for 5-bromopyrazine-2,3-diamine is Nc1ncc(Br)nc1N.
What is the InChIKey of 5-bromopyrazine-2,3-diamine?
The InChIKey is CPYAUFLEMLTQAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5BrN4/c5-2-1-8-3(6)4(7)9-2/h1H,(H2,6,8)(H2,7,9).
What are the key properties of 5-bromopyrazine-2,3-diamine?
5-bromopyrazine-2,3-diamine has a molecular weight of 189.02 g/mol, XLogP of 0.40, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromopyrazine-2,3-diamine is sourced from PubChem (CID 2771857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).