C4H6N4OS — CID 2771907
5-sulfanylidene-1,3,3a,4,6,6a-hexahydroimidazo[4,5-d]imidazol-2-one (PubChem CID 2771907) has the molecular formula C4H6N4OS and a molecular weight of 158.19 g/mol. Its IUPAC name is 5-sulfanylidene-1,3,3a,4,6,6a-hexahydroimidazo[4,5-d]imidazol-2-one.
| Compound Name | 5-sulfanylidene-1,3,3a,4,6,6a-hexahydroimidazo[4,5-d]imidazol-2-one |
|---|---|
| PubChem CID | 2771907 |
| Molecular Formula | C4H6N4OS |
| Molecular Weight | 158.19 g/mol |
| Exact Mass | 158.03 |
| IUPAC Name | 5-sulfanylidene-1,3,3a,4,6,6a-hexahydroimidazo[4,5-d]imidazol-2-one |
| SMILES | O=C1NC2NC(=S)NC2N1 |
| InChI | InChI=1S/C4H6N4OS/c9-3-5-1-2(6-3)8-4(10)7-1/h1-2H,(H2,5,6,9)(H2,7,8,10) |
| InChIKey | GUPCSRQTWWHGMO-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.19 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|