C12H21N3O3S — CID 2771978
tert-butyl N-[(1S)-2-methyl-1-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)butyl]carbamate (PubChem CID 2771978) has the molecular formula C12H21N3O3S and a molecular weight of 287.39 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2-methyl-1-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)butyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-2-methyl-1-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)butyl]carbamate |
|---|---|
| PubChem CID | 2771978 |
| Molecular Formula | C12H21N3O3S |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | tert-butyl N-[(1S)-2-methyl-1-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)butyl]carbamate |
| SMILES | CCC(C)[C@H](NC(=O)OC(C)(C)C)c1n[nH]c(=S)o1 |
| InChI | InChI=1S/C12H21N3O3S/c1-6-7(2)8(9-14-15-11(19)17-9)13-10(16)18-12(3,4)5/h7-8H,6H2,1-5H3,(H,13,16)(H,15,19)/t7?,8-/m0/s1 |
| InChIKey | VFNSGEYIBUASLR-MQWKRIRWSA-N |
| XLogP | 3.34 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|