About N-[1-(3,4-dimethoxyphenyl)but-3-enyl]aniline
N-[1-(3,4-dimethoxyphenyl)but-3-enyl]aniline (PubChem CID 2772055) has the molecular formula C18H21NO2
and a molecular weight of 283.37 g/mol. Its IUPAC name is N-[1-(3,4-dimethoxyphenyl)but-3-enyl]aniline.
Molecular Properties
| Compound Name | N-[1-(3,4-dimethoxyphenyl)but-3-enyl]aniline |
| PubChem CID | 2772055 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | N-[1-(3,4-dimethoxyphenyl)but-3-enyl]aniline |
| SMILES | C=CCC(Nc1ccccc1)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C18H21NO2/c1-4-8-16(19-15-9-6-5-7-10-15)14-11-12-17(20-2)18(13-14)21-3/h4-7,9-13,16,19H,1,8H2,2-3H3 |
| InChIKey | XQAOERIZYMRWSJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(3,4-dimethoxyphenyl)but-3-enyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(3,4-dimethoxyphenyl)but-3-enyl]aniline?
The IUPAC name of N-[1-(3,4-dimethoxyphenyl)but-3-enyl]aniline (CID 2772055) is N-[1-(3,4-dimethoxyphenyl)but-3-enyl]aniline.
What is the SMILES notation for N-[1-(3,4-dimethoxyphenyl)but-3-enyl]aniline?
The canonical SMILES for N-[1-(3,4-dimethoxyphenyl)but-3-enyl]aniline is C=CCC(Nc1ccccc1)c1ccc(OC)c(OC)c1.
What is the InChIKey of N-[1-(3,4-dimethoxyphenyl)but-3-enyl]aniline?
The InChIKey is XQAOERIZYMRWSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO2/c1-4-8-16(19-15-9-6-5-7-10-15)14-11-12-17(20-2)18(13-14)21-3/h4-7,9-13,16,19H,1,8H2,2-3H3.
What are the key properties of N-[1-(3,4-dimethoxyphenyl)but-3-enyl]aniline?
N-[1-(3,4-dimethoxyphenyl)but-3-enyl]aniline has a molecular weight of 283.37 g/mol, XLogP of 4.43, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(3,4-dimethoxyphenyl)but-3-enyl]aniline is sourced from PubChem (CID 2772055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).