About 2-[2,2-dimethyl-4-[3-(trifluoromethyl)phenyl]oxan-4-yl]ethanamine
2-[2,2-dimethyl-4-[3-(trifluoromethyl)phenyl]oxan-4-yl]ethanamine (PubChem CID 2772142) has the molecular formula C16H22F3NO
and a molecular weight of 301.35 g/mol. Its IUPAC name is 2-[2,2-dimethyl-4-[3-(trifluoromethyl)phenyl]oxan-4-yl]ethanamine.
Molecular Properties
| Compound Name | 2-[2,2-dimethyl-4-[3-(trifluoromethyl)phenyl]oxan-4-yl]ethanamine |
| PubChem CID | 2772142 |
| Molecular Formula | C16H22F3NO |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 2-[2,2-dimethyl-4-[3-(trifluoromethyl)phenyl]oxan-4-yl]ethanamine |
| SMILES | CC1(C)CC(CCN)(c2cccc(C(F)(F)F)c2)CCO1 |
| InChI | InChI=1S/C16H22F3NO/c1-14(2)11-15(6-8-20,7-9-21-14)12-4-3-5-13(10-12)16(17,18)19/h3-5,10H,6-9,11,20H2,1-2H3 |
| InChIKey | CFLWWOUJHSGOBX-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[2,2-dimethyl-4-[3-(trifluoromethyl)phenyl]oxan-4-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,2-dimethyl-4-[3-(trifluoromethyl)phenyl]oxan-4-yl]ethanamine?
The IUPAC name of 2-[2,2-dimethyl-4-[3-(trifluoromethyl)phenyl]oxan-4-yl]ethanamine (CID 2772142) is 2-[2,2-dimethyl-4-[3-(trifluoromethyl)phenyl]oxan-4-yl]ethanamine.
What is the SMILES notation for 2-[2,2-dimethyl-4-[3-(trifluoromethyl)phenyl]oxan-4-yl]ethanamine?
The canonical SMILES for 2-[2,2-dimethyl-4-[3-(trifluoromethyl)phenyl]oxan-4-yl]ethanamine is CC1(C)CC(CCN)(c2cccc(C(F)(F)F)c2)CCO1.
What is the InChIKey of 2-[2,2-dimethyl-4-[3-(trifluoromethyl)phenyl]oxan-4-yl]ethanamine?
The InChIKey is CFLWWOUJHSGOBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22F3NO/c1-14(2)11-15(6-8-20,7-9-21-14)12-4-3-5-13(10-12)16(17,18)19/h3-5,10H,6-9,11,20H2,1-2H3.
What are the key properties of 2-[2,2-dimethyl-4-[3-(trifluoromethyl)phenyl]oxan-4-yl]ethanamine?
2-[2,2-dimethyl-4-[3-(trifluoromethyl)phenyl]oxan-4-yl]ethanamine has a molecular weight of 301.35 g/mol, XLogP of 3.88, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,2-dimethyl-4-[3-(trifluoromethyl)phenyl]oxan-4-yl]ethanamine is sourced from PubChem (CID 2772142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).