About 5-formyl-1,4-dimethyl-6-morpholin-4-yl-2-oxopyridine-3-carbonitrile
5-formyl-1,4-dimethyl-6-morpholin-4-yl-2-oxopyridine-3-carbonitrile (PubChem CID 2772193) has the molecular formula C13H15N3O3
and a molecular weight of 261.28 g/mol. Its IUPAC name is 5-formyl-1,4-dimethyl-6-morpholin-4-yl-2-oxopyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 5-formyl-1,4-dimethyl-6-morpholin-4-yl-2-oxopyridine-3-carbonitrile |
| PubChem CID | 2772193 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 5-formyl-1,4-dimethyl-6-morpholin-4-yl-2-oxopyridine-3-carbonitrile |
| SMILES | Cc1c(C=O)c(N2CCOCC2)n(C)c(=O)c1C#N |
| InChI | InChI=1S/C13H15N3O3/c1-9-10(7-14)13(18)15(2)12(11(9)8-17)16-3-5-19-6-4-16/h8H,3-6H2,1-2H3 |
| InChIKey | TUQHZCJNHCCRBF-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 75.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-formyl-1,4-dimethyl-6-morpholin-4-yl-2-oxopyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-formyl-1,4-dimethyl-6-morpholin-4-yl-2-oxopyridine-3-carbonitrile?
The IUPAC name of 5-formyl-1,4-dimethyl-6-morpholin-4-yl-2-oxopyridine-3-carbonitrile (CID 2772193) is 5-formyl-1,4-dimethyl-6-morpholin-4-yl-2-oxopyridine-3-carbonitrile.
What is the SMILES notation for 5-formyl-1,4-dimethyl-6-morpholin-4-yl-2-oxopyridine-3-carbonitrile?
The canonical SMILES for 5-formyl-1,4-dimethyl-6-morpholin-4-yl-2-oxopyridine-3-carbonitrile is Cc1c(C=O)c(N2CCOCC2)n(C)c(=O)c1C#N.
What is the InChIKey of 5-formyl-1,4-dimethyl-6-morpholin-4-yl-2-oxopyridine-3-carbonitrile?
The InChIKey is TUQHZCJNHCCRBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O3/c1-9-10(7-14)13(18)15(2)12(11(9)8-17)16-3-5-19-6-4-16/h8H,3-6H2,1-2H3.
What are the key properties of 5-formyl-1,4-dimethyl-6-morpholin-4-yl-2-oxopyridine-3-carbonitrile?
5-formyl-1,4-dimethyl-6-morpholin-4-yl-2-oxopyridine-3-carbonitrile has a molecular weight of 261.28 g/mol, XLogP of 0.21, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-formyl-1,4-dimethyl-6-morpholin-4-yl-2-oxopyridine-3-carbonitrile is sourced from PubChem (CID 2772193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).