2-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]acetic acid

C6H11NO5S — CID 2772235

IUPAC2-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]acetic acid
SMILESO=C(O)CNC1CS(=O)(=O)CC1O
InChIInChI=1S/C6H11NO5S/c8-5-3-13(11,12)2-4(5)7-1-6(9)10/h4-5,7-8H,1-3H2,(H,9,10)
InChIKeySTVZCHIOQLIKAY-UHFFFAOYSA-N
MW209.22 g/mol
LogP-2.18
Rot. Bonds3

About 2-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]acetic acid

2-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]acetic acid (PubChem CID 2772235) has the molecular formula C6H11NO5S and a molecular weight of 209.22 g/mol. Its IUPAC name is 2-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]acetic acid.

Molecular Properties

Compound Name2-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]acetic acid
PubChem CID2772235
Molecular FormulaC6H11NO5S
Molecular Weight209.22 g/mol
Exact Mass209.04
IUPAC Name2-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]acetic acid
SMILESO=C(O)CNC1CS(=O)(=O)CC1O
InChIInChI=1S/C6H11NO5S/c8-5-3-13(11,12)2-4(5)7-1-6(9)10/h4-5,7-8H,1-3H2,(H,9,10)
InChIKeySTVZCHIOQLIKAY-UHFFFAOYSA-N
XLogP-2.18
TPSA103.70 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.22
LogP ≤ 5-2.18
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 2-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]acetic acid?
The IUPAC name of 2-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]acetic acid (CID 2772235) is 2-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]acetic acid.
What is the SMILES notation for 2-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]acetic acid?
The canonical SMILES for 2-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]acetic acid is O=C(O)CNC1CS(=O)(=O)CC1O.
What is the InChIKey of 2-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]acetic acid?
The InChIKey is STVZCHIOQLIKAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO5S/c8-5-3-13(11,12)2-4(5)7-1-6(9)10/h4-5,7-8H,1-3H2,(H,9,10).
What are the key properties of 2-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]acetic acid?
2-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]acetic acid has a molecular weight of 209.22 g/mol, XLogP of -2.18, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]acetic acid is sourced from PubChem (CID 2772235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).