2-(furan-2-yl)benzoic acid

C11H8O3 — CID 2772293

IUPAC2-(furan-2-yl)benzoic acid
SMILESO=C(O)c1ccccc1-c1ccco1
InChIInChI=1S/C11H8O3/c12-11(13)9-5-2-1-4-8(9)10-6-3-7-14-10/h1-7H,(H,12,13)
InChIKeyQRUHYAWZHFTNEA-UHFFFAOYSA-N
MW188.18 g/mol
LogP2.64
Rot. Bonds2

About 2-(furan-2-yl)benzoic acid

2-(furan-2-yl)benzoic acid (PubChem CID 2772293) has the molecular formula C11H8O3 and a molecular weight of 188.18 g/mol. Its IUPAC name is 2-(furan-2-yl)benzoic acid.

Molecular Properties

Compound Name2-(furan-2-yl)benzoic acid
PubChem CID2772293
Molecular FormulaC11H8O3
Molecular Weight188.18 g/mol
Exact Mass188.05
IUPAC Name2-(furan-2-yl)benzoic acid
SMILESO=C(O)c1ccccc1-c1ccco1
InChIInChI=1S/C11H8O3/c12-11(13)9-5-2-1-4-8(9)10-6-3-7-14-10/h1-7H,(H,12,13)
InChIKeyQRUHYAWZHFTNEA-UHFFFAOYSA-N
XLogP2.64
TPSA50.44 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500188.18
LogP ≤ 52.64
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(furan-2-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(furan-2-yl)benzoic acid?
The IUPAC name of 2-(furan-2-yl)benzoic acid (CID 2772293) is 2-(furan-2-yl)benzoic acid.
What is the SMILES notation for 2-(furan-2-yl)benzoic acid?
The canonical SMILES for 2-(furan-2-yl)benzoic acid is O=C(O)c1ccccc1-c1ccco1.
What is the InChIKey of 2-(furan-2-yl)benzoic acid?
The InChIKey is QRUHYAWZHFTNEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8O3/c12-11(13)9-5-2-1-4-8(9)10-6-3-7-14-10/h1-7H,(H,12,13).
What are the key properties of 2-(furan-2-yl)benzoic acid?
2-(furan-2-yl)benzoic acid has a molecular weight of 188.18 g/mol, XLogP of 2.64, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(furan-2-yl)benzoic acid is sourced from PubChem (CID 2772293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).