About 3-(3-aminophenyl)benzoic acid
3-(3-aminophenyl)benzoic acid (PubChem CID 2772299) has the molecular formula C13H11NO2
and a molecular weight of 213.24 g/mol. Its IUPAC name is 3-(3-aminophenyl)benzoic acid.
Molecular Properties
| Compound Name | 3-(3-aminophenyl)benzoic acid |
| PubChem CID | 2772299 |
| Molecular Formula | C13H11NO2 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 3-(3-aminophenyl)benzoic acid |
| SMILES | Nc1cccc(-c2cccc(C(=O)O)c2)c1 |
| InChI | InChI=1S/C13H11NO2/c14-12-6-2-4-10(8-12)9-3-1-5-11(7-9)13(15)16/h1-8H,14H2,(H,15,16) |
| InChIKey | RQKFSJNOPKCEJI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-aminophenyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-aminophenyl)benzoic acid?
The IUPAC name of 3-(3-aminophenyl)benzoic acid (CID 2772299) is 3-(3-aminophenyl)benzoic acid.
What is the SMILES notation for 3-(3-aminophenyl)benzoic acid?
The canonical SMILES for 3-(3-aminophenyl)benzoic acid is Nc1cccc(-c2cccc(C(=O)O)c2)c1.
What is the InChIKey of 3-(3-aminophenyl)benzoic acid?
The InChIKey is RQKFSJNOPKCEJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO2/c14-12-6-2-4-10(8-12)9-3-1-5-11(7-9)13(15)16/h1-8H,14H2,(H,15,16).
What are the key properties of 3-(3-aminophenyl)benzoic acid?
3-(3-aminophenyl)benzoic acid has a molecular weight of 213.24 g/mol, XLogP of 2.63, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-aminophenyl)benzoic acid is sourced from PubChem (CID 2772299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).