About 5-methoxy-3H-1,3-benzoxazole-2-thione
5-methoxy-3H-1,3-benzoxazole-2-thione (PubChem CID 2772389) has the molecular formula C8H7NO2S
and a molecular weight of 181.22 g/mol. Its IUPAC name is 5-methoxy-3H-1,3-benzoxazole-2-thione.
Molecular Properties
| Compound Name | 5-methoxy-3H-1,3-benzoxazole-2-thione |
| PubChem CID | 2772389 |
| Molecular Formula | C8H7NO2S |
| Molecular Weight | 181.22 g/mol |
| Exact Mass | 181.02 |
| IUPAC Name | 5-methoxy-3H-1,3-benzoxazole-2-thione |
| SMILES | COc1ccc2oc(=S)[nH]c2c1 |
| InChI | InChI=1S/C8H7NO2S/c1-10-5-2-3-7-6(4-5)9-8(12)11-7/h2-4H,1H3,(H,9,12) |
| InChIKey | QGTUVLRFJOUWBN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 38.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.22 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-3H-1,3-benzoxazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-3H-1,3-benzoxazole-2-thione?
The IUPAC name of 5-methoxy-3H-1,3-benzoxazole-2-thione (CID 2772389) is 5-methoxy-3H-1,3-benzoxazole-2-thione.
What is the SMILES notation for 5-methoxy-3H-1,3-benzoxazole-2-thione?
The canonical SMILES for 5-methoxy-3H-1,3-benzoxazole-2-thione is COc1ccc2oc(=S)[nH]c2c1.
What is the InChIKey of 5-methoxy-3H-1,3-benzoxazole-2-thione?
The InChIKey is QGTUVLRFJOUWBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO2S/c1-10-5-2-3-7-6(4-5)9-8(12)11-7/h2-4H,1H3,(H,9,12).
What are the key properties of 5-methoxy-3H-1,3-benzoxazole-2-thione?
5-methoxy-3H-1,3-benzoxazole-2-thione has a molecular weight of 181.22 g/mol, XLogP of 2.50, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-3H-1,3-benzoxazole-2-thione is sourced from PubChem (CID 2772389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).