C10H17N3O — CID 2772401
3,5-dimethyl-4-(piperazin-1-ylmethyl)-1,2-oxazole (PubChem CID 2772401) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is 3,5-dimethyl-4-(piperazin-1-ylmethyl)-1,2-oxazole.
| Compound Name | 3,5-dimethyl-4-(piperazin-1-ylmethyl)-1,2-oxazole |
|---|---|
| PubChem CID | 2772401 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 3,5-dimethyl-4-(piperazin-1-ylmethyl)-1,2-oxazole |
| SMILES | Cc1noc(C)c1CN1CCNCC1 |
| InChI | InChI=1S/C10H17N3O/c1-8-10(9(2)14-12-8)7-13-5-3-11-4-6-13/h11H,3-7H2,1-2H3 |
| InChIKey | LJPFGGDQLGMPPG-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |