About 2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanoic acid
2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanoic acid (PubChem CID 2772430) has the molecular formula C7H10N4O2S
and a molecular weight of 214.25 g/mol. Its IUPAC name is 2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanoic acid.
Molecular Properties
| Compound Name | 2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanoic acid |
| PubChem CID | 2772430 |
| Molecular Formula | C7H10N4O2S |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanoic acid |
| SMILES | CC(Sc1nc(N)cc(N)n1)C(=O)O |
| InChI | InChI=1S/C7H10N4O2S/c1-3(6(12)13)14-7-10-4(8)2-5(9)11-7/h2-3H,1H3,(H,12,13)(H4,8,9,10,11) |
| InChIKey | VMMSKDJWIWBHJL-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 115.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanoic acid?
The IUPAC name of 2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanoic acid (CID 2772430) is 2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanoic acid.
What is the SMILES notation for 2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanoic acid?
The canonical SMILES for 2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanoic acid is CC(Sc1nc(N)cc(N)n1)C(=O)O.
What is the InChIKey of 2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanoic acid?
The InChIKey is VMMSKDJWIWBHJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4O2S/c1-3(6(12)13)14-7-10-4(8)2-5(9)11-7/h2-3H,1H3,(H,12,13)(H4,8,9,10,11).
What are the key properties of 2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanoic acid?
2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanoic acid has a molecular weight of 214.25 g/mol, XLogP of 0.21, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,6-diaminopyrimidin-2-yl)sulfanylpropanoic acid is sourced from PubChem (CID 2772430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).