C13H12N6O2S — CID 2772829
2-[(8-methyl-1,8,10,11,13,14-hexazatetracyclo[7.6.0.02,7.011,15]pentadeca-2,4,6,9,12,14-hexaen-12-yl)sulfanyl]propanoic acid (PubChem CID 2772829) has the molecular formula C13H12N6O2S and a molecular weight of 316.35 g/mol. Its IUPAC name is 2-[(8-methyl-1,8,10,11,13,14-hexazatetracyclo[7.6.0.02,7.011,15]pentadeca-2,4,6,9,12,14-hexaen-12-yl)sulfanyl]propanoic acid.
| Compound Name | 2-[(8-methyl-1,8,10,11,13,14-hexazatetracyclo[7.6.0.02,7.011,15]pentadeca-2,4,6,9,12,14-hexaen-12-yl)sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 2772829 |
| Molecular Formula | C13H12N6O2S |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 2-[(8-methyl-1,8,10,11,13,14-hexazatetracyclo[7.6.0.02,7.011,15]pentadeca-2,4,6,9,12,14-hexaen-12-yl)sulfanyl]propanoic acid |
| SMILES | CC(Sc1nnc2n1nc1n(C)c3ccccc3n12)C(=O)O |
| InChI | InChI=1S/C13H12N6O2S/c1-7(10(20)21)22-13-15-14-11-18-9-6-4-3-5-8(9)17(2)12(18)16-19(11)13/h3-7H,1-2H3,(H,20,21) |
| InChIKey | DCUYVNPZVPZIPU-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 89.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |