About N-cyclopentyl-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide
N-cyclopentyl-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide (PubChem CID 2772852) has the molecular formula C13H19N3OS
and a molecular weight of 265.38 g/mol. Its IUPAC name is N-cyclopentyl-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide.
Molecular Properties
| Compound Name | N-cyclopentyl-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide |
| PubChem CID | 2772852 |
| Molecular Formula | C13H19N3OS |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | N-cyclopentyl-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide |
| SMILES | Cc1cc(C)nc(SCC(=O)NC2CCCC2)n1 |
| InChI | InChI=1S/C13H19N3OS/c1-9-7-10(2)15-13(14-9)18-8-12(17)16-11-5-3-4-6-11/h7,11H,3-6,8H2,1-2H3,(H,16,17) |
| InChIKey | VRQWKFKZBRDMIV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cyclopentyl-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide?
The IUPAC name of N-cyclopentyl-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide (CID 2772852) is N-cyclopentyl-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide.
What is the SMILES notation for N-cyclopentyl-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide?
The canonical SMILES for N-cyclopentyl-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide is Cc1cc(C)nc(SCC(=O)NC2CCCC2)n1.
What is the InChIKey of N-cyclopentyl-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide?
The InChIKey is VRQWKFKZBRDMIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3OS/c1-9-7-10(2)15-13(14-9)18-8-12(17)16-11-5-3-4-6-11/h7,11H,3-6,8H2,1-2H3,(H,16,17).
What are the key properties of N-cyclopentyl-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide?
N-cyclopentyl-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide has a molecular weight of 265.38 g/mol, XLogP of 2.24, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide is sourced from PubChem (CID 2772852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).