About 5-amino-1,3-dihydroindol-2-one
5-amino-1,3-dihydroindol-2-one (PubChem CID 2773213) has the molecular formula C8H8N2O
and a molecular weight of 148.16 g/mol. Its IUPAC name is 5-amino-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 5-amino-1,3-dihydroindol-2-one |
| PubChem CID | 2773213 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 5-amino-1,3-dihydroindol-2-one |
| SMILES | Nc1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C8H8N2O/c9-6-1-2-7-5(3-6)4-8(11)10-7/h1-3H,4,9H2,(H,10,11) |
| InChIKey | JPUYXUBUJJDJNL-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1,3-dihydroindol-2-one?
The IUPAC name of 5-amino-1,3-dihydroindol-2-one (CID 2773213) is 5-amino-1,3-dihydroindol-2-one.
What is the SMILES notation for 5-amino-1,3-dihydroindol-2-one?
The canonical SMILES for 5-amino-1,3-dihydroindol-2-one is Nc1ccc2c(c1)CC(=O)N2.
What is the InChIKey of 5-amino-1,3-dihydroindol-2-one?
The InChIKey is JPUYXUBUJJDJNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O/c9-6-1-2-7-5(3-6)4-8(11)10-7/h1-3H,4,9H2,(H,10,11).
What are the key properties of 5-amino-1,3-dihydroindol-2-one?
5-amino-1,3-dihydroindol-2-one has a molecular weight of 148.16 g/mol, XLogP of 0.76, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1,3-dihydroindol-2-one is sourced from PubChem (CID 2773213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).