About 1-ethenyl-3,5-bis(trifluoromethyl)benzene
1-ethenyl-3,5-bis(trifluoromethyl)benzene (PubChem CID 2773242) has the molecular formula C10H6F6
and a molecular weight of 240.15 g/mol. Its IUPAC name is 1-ethenyl-3,5-bis(trifluoromethyl)benzene.
Molecular Properties
| Compound Name | 1-ethenyl-3,5-bis(trifluoromethyl)benzene |
| PubChem CID | 2773242 |
| Molecular Formula | C10H6F6 |
| Molecular Weight | 240.15 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | 1-ethenyl-3,5-bis(trifluoromethyl)benzene |
| SMILES | C=Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H6F6/c1-2-6-3-7(9(11,12)13)5-8(4-6)10(14,15)16/h2-5H,1H2 |
| InChIKey | LFICVUCVPKKPFF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.15 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-ethenyl-3,5-bis(trifluoromethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-3,5-bis(trifluoromethyl)benzene?
The IUPAC name of 1-ethenyl-3,5-bis(trifluoromethyl)benzene (CID 2773242) is 1-ethenyl-3,5-bis(trifluoromethyl)benzene.
What is the SMILES notation for 1-ethenyl-3,5-bis(trifluoromethyl)benzene?
The canonical SMILES for 1-ethenyl-3,5-bis(trifluoromethyl)benzene is C=Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of 1-ethenyl-3,5-bis(trifluoromethyl)benzene?
The InChIKey is LFICVUCVPKKPFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6F6/c1-2-6-3-7(9(11,12)13)5-8(4-6)10(14,15)16/h2-5H,1H2.
What are the key properties of 1-ethenyl-3,5-bis(trifluoromethyl)benzene?
1-ethenyl-3,5-bis(trifluoromethyl)benzene has a molecular weight of 240.15 g/mol, XLogP of 4.37, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-3,5-bis(trifluoromethyl)benzene is sourced from PubChem (CID 2773242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).