About 5-bromo-2-chloro-1,3-difluorobenzene
5-bromo-2-chloro-1,3-difluorobenzene (PubChem CID 2773258) has the molecular formula C6H2BrClF2
and a molecular weight of 227.43 g/mol. Its IUPAC name is 5-bromo-2-chloro-1,3-difluorobenzene.
Molecular Properties
| Compound Name | 5-bromo-2-chloro-1,3-difluorobenzene |
| PubChem CID | 2773258 |
| Molecular Formula | C6H2BrClF2 |
| Molecular Weight | 227.43 g/mol |
| Exact Mass | 225.90 |
| IUPAC Name | 5-bromo-2-chloro-1,3-difluorobenzene |
| SMILES | Fc1cc(Br)cc(F)c1Cl |
| InChI | InChI=1S/C6H2BrClF2/c7-3-1-4(9)6(8)5(10)2-3/h1-2H |
| InChIKey | SWELJVAWQMCJLG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-chloro-1,3-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-chloro-1,3-difluorobenzene?
The IUPAC name of 5-bromo-2-chloro-1,3-difluorobenzene (CID 2773258) is 5-bromo-2-chloro-1,3-difluorobenzene.
What is the SMILES notation for 5-bromo-2-chloro-1,3-difluorobenzene?
The canonical SMILES for 5-bromo-2-chloro-1,3-difluorobenzene is Fc1cc(Br)cc(F)c1Cl.
What is the InChIKey of 5-bromo-2-chloro-1,3-difluorobenzene?
The InChIKey is SWELJVAWQMCJLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2BrClF2/c7-3-1-4(9)6(8)5(10)2-3/h1-2H.
What are the key properties of 5-bromo-2-chloro-1,3-difluorobenzene?
5-bromo-2-chloro-1,3-difluorobenzene has a molecular weight of 227.43 g/mol, XLogP of 3.38, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-chloro-1,3-difluorobenzene is sourced from PubChem (CID 2773258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).