C9H6N2O — CID 2773346
2-oxo-1,3-dihydroindole-5-carbonitrile (PubChem CID 2773346) has the molecular formula C9H6N2O and a molecular weight of 158.16 g/mol. Its IUPAC name is 2-oxo-1,3-dihydroindole-5-carbonitrile.
| Compound Name | 2-oxo-1,3-dihydroindole-5-carbonitrile |
|---|---|
| PubChem CID | 2773346 |
| Molecular Formula | C9H6N2O |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | 2-oxo-1,3-dihydroindole-5-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C9H6N2O/c10-5-6-1-2-8-7(3-6)4-9(12)11-8/h1-3H,4H2,(H,11,12) |
| InChIKey | NZOSLRYUVHMXTQ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |