About (2,5-dichlorophenyl)boronic acid
(2,5-dichlorophenyl)boronic acid (PubChem CID 2773371) has the molecular formula C6H5BCl2O2
and a molecular weight of 190.82 g/mol. Its IUPAC name is (2,5-dichlorophenyl)boronic acid.
Molecular Properties
| Compound Name | (2,5-dichlorophenyl)boronic acid |
| PubChem CID | 2773371 |
| Molecular Formula | C6H5BCl2O2 |
| Molecular Weight | 190.82 g/mol |
| Exact Mass | 189.98 |
| IUPAC Name | (2,5-dichlorophenyl)boronic acid |
| SMILES | OB(O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C6H5BCl2O2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,10-11H |
| InChIKey | NNTFPBXQPOQRBT-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.82 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dichlorophenyl)boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dichlorophenyl)boronic acid?
The IUPAC name of (2,5-dichlorophenyl)boronic acid (CID 2773371) is (2,5-dichlorophenyl)boronic acid.
What is the SMILES notation for (2,5-dichlorophenyl)boronic acid?
The canonical SMILES for (2,5-dichlorophenyl)boronic acid is OB(O)c1cc(Cl)ccc1Cl.
What is the InChIKey of (2,5-dichlorophenyl)boronic acid?
The InChIKey is NNTFPBXQPOQRBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5BCl2O2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,10-11H.
What are the key properties of (2,5-dichlorophenyl)boronic acid?
(2,5-dichlorophenyl)boronic acid has a molecular weight of 190.82 g/mol, XLogP of 0.67, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dichlorophenyl)boronic acid is sourced from PubChem (CID 2773371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).