About 1H-indole-6-carbaldehyde
1H-indole-6-carbaldehyde (PubChem CID 2773435) has the molecular formula C9H7NO
and a molecular weight of 145.16 g/mol. Its IUPAC name is 1H-indole-6-carbaldehyde.
Molecular Properties
| Compound Name | 1H-indole-6-carbaldehyde |
| PubChem CID | 2773435 |
| Molecular Formula | C9H7NO |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.05 |
| IUPAC Name | 1H-indole-6-carbaldehyde |
| SMILES | O=Cc1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C9H7NO/c11-6-7-1-2-8-3-4-10-9(8)5-7/h1-6,10H |
| InChIKey | VSPBWOAEHQDXRD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1H-indole-6-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indole-6-carbaldehyde?
The IUPAC name of 1H-indole-6-carbaldehyde (CID 2773435) is 1H-indole-6-carbaldehyde.
What is the SMILES notation for 1H-indole-6-carbaldehyde?
The canonical SMILES for 1H-indole-6-carbaldehyde is O=Cc1ccc2cc[nH]c2c1.
What is the InChIKey of 1H-indole-6-carbaldehyde?
The InChIKey is VSPBWOAEHQDXRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO/c11-6-7-1-2-8-3-4-10-9(8)5-7/h1-6,10H.
What are the key properties of 1H-indole-6-carbaldehyde?
1H-indole-6-carbaldehyde has a molecular weight of 145.16 g/mol, XLogP of 1.98, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indole-6-carbaldehyde is sourced from PubChem (CID 2773435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).