About 4-iodo-1-methylimidazole
4-iodo-1-methylimidazole (PubChem CID 2773463) has the molecular formula C4H5IN2
and a molecular weight of 208.00 g/mol. Its IUPAC name is 4-iodo-1-methylimidazole.
Molecular Properties
| Compound Name | 4-iodo-1-methylimidazole |
| PubChem CID | 2773463 |
| Molecular Formula | C4H5IN2 |
| Molecular Weight | 208.00 g/mol |
| Exact Mass | 207.95 |
| IUPAC Name | 4-iodo-1-methylimidazole |
| SMILES | Cn1cnc(I)c1 |
| InChI | InChI=1S/C4H5IN2/c1-7-2-4(5)6-3-7/h2-3H,1H3 |
| InChIKey | HUQSHNLGOKQVHA-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.00 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-iodo-1-methylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-iodo-1-methylimidazole?
The IUPAC name of 4-iodo-1-methylimidazole (CID 2773463) is 4-iodo-1-methylimidazole.
What is the SMILES notation for 4-iodo-1-methylimidazole?
The canonical SMILES for 4-iodo-1-methylimidazole is Cn1cnc(I)c1.
What is the InChIKey of 4-iodo-1-methylimidazole?
The InChIKey is HUQSHNLGOKQVHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5IN2/c1-7-2-4(5)6-3-7/h2-3H,1H3.
What are the key properties of 4-iodo-1-methylimidazole?
4-iodo-1-methylimidazole has a molecular weight of 208.00 g/mol, XLogP of 1.02, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-iodo-1-methylimidazole is sourced from PubChem (CID 2773463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).