C12H16BNO4 — CID 2773555
4,4,5,5-Tetramethyl-2-(4-nitrophenyl)-1,3,2-dioxaborolane (PubChem CID 2773555) has the molecular formula C12H16BNO4 and a molecular weight of 249.07 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-(4-nitrophenyl)-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-Tetramethyl-2-(4-nitrophenyl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 2773555 |
| Molecular Formula | C12H16BNO4 |
| Molecular Weight | 249.07 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-(4-nitrophenyl)-1,3,2-dioxaborolane |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)[N+](=O)[O-] |
| InChI | InChI=1S/C12H16BNO4/c1-11(2)12(3,4)18-13(17-11)9-5-7-10(8-6-9)14(15)16/h5-8H,1-4H3 |
| InChIKey | LUWACRUAJXZANC-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 64.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | 315 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|