About 2-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)ethyl-dimethylazanium dichloride
2-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)ethyl-dimethylazanium dichloride (PubChem CID 27736) has the molecular formula C7H17Cl2N3S
and a molecular weight of 246.21 g/mol. Its IUPAC name is 2-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)ethyl-dimethylazanium dichloride.
Molecular Properties
| Compound Name | 2-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)ethyl-dimethylazanium dichloride |
| PubChem CID | 27736 |
| Molecular Formula | C7H17Cl2N3S |
| Molecular Weight | 246.21 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 2-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)ethyl-dimethylazanium dichloride |
| SMILES | C[NH+](C)CCSC1=NCC[NH2+]1.[Cl-].[Cl-] |
| InChI | InChI=1S/C7H15N3S.2ClH/c1-10(2)5-6-11-7-8-3-4-9-7;;/h3-6H2,1-2H3,(H,8,9);2*1H |
| InChIKey | URUZINKWOOUTTH-UHFFFAOYSA-N |
| XLogP | -8.19 |
| TPSA | 33.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.21 |
| LogP ≤ 5 | -8.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)ethyl-dimethylazanium dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)ethyl-dimethylazanium dichloride?
The IUPAC name of 2-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)ethyl-dimethylazanium dichloride (CID 27736) is 2-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)ethyl-dimethylazanium dichloride.
What is the SMILES notation for 2-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)ethyl-dimethylazanium dichloride?
The canonical SMILES for 2-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)ethyl-dimethylazanium dichloride is C[NH+](C)CCSC1=NCC[NH2+]1.[Cl-].[Cl-].
What is the InChIKey of 2-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)ethyl-dimethylazanium dichloride?
The InChIKey is URUZINKWOOUTTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N3S.2ClH/c1-10(2)5-6-11-7-8-3-4-9-7;;/h3-6H2,1-2H3,(H,8,9);2*1H.
What are the key properties of 2-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)ethyl-dimethylazanium dichloride?
2-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)ethyl-dimethylazanium dichloride has a molecular weight of 246.21 g/mol, XLogP of -8.19, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)ethyl-dimethylazanium dichloride is sourced from PubChem (CID 27736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).