About (2-diethoxyphosphoryl-4,4-diethoxybutyl)benzene
(2-diethoxyphosphoryl-4,4-diethoxybutyl)benzene (PubChem CID 2773701) has the molecular formula C18H31O5P
and a molecular weight of 358.42 g/mol. Its IUPAC name is (2-diethoxyphosphoryl-4,4-diethoxybutyl)benzene.
Molecular Properties
| Compound Name | (2-diethoxyphosphoryl-4,4-diethoxybutyl)benzene |
| PubChem CID | 2773701 |
| Molecular Formula | C18H31O5P |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | (2-diethoxyphosphoryl-4,4-diethoxybutyl)benzene |
| SMILES | CCOC(CC(Cc1ccccc1)P(=O)(OCC)OCC)OCC |
| InChI | InChI=1S/C18H31O5P/c1-5-20-18(21-6-2)15-17(14-16-12-10-9-11-13-16)24(19,22-7-3)23-8-4/h9-13,17-18H,5-8,14-15H2,1-4H3 |
| InChIKey | YTUGDFXSYQEFLV-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2-diethoxyphosphoryl-4,4-diethoxybutyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-diethoxyphosphoryl-4,4-diethoxybutyl)benzene?
The IUPAC name of (2-diethoxyphosphoryl-4,4-diethoxybutyl)benzene (CID 2773701) is (2-diethoxyphosphoryl-4,4-diethoxybutyl)benzene.
What is the SMILES notation for (2-diethoxyphosphoryl-4,4-diethoxybutyl)benzene?
The canonical SMILES for (2-diethoxyphosphoryl-4,4-diethoxybutyl)benzene is CCOC(CC(Cc1ccccc1)P(=O)(OCC)OCC)OCC.
What is the InChIKey of (2-diethoxyphosphoryl-4,4-diethoxybutyl)benzene?
The InChIKey is YTUGDFXSYQEFLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H31O5P/c1-5-20-18(21-6-2)15-17(14-16-12-10-9-11-13-16)24(19,22-7-3)23-8-4/h9-13,17-18H,5-8,14-15H2,1-4H3.
What are the key properties of (2-diethoxyphosphoryl-4,4-diethoxybutyl)benzene?
(2-diethoxyphosphoryl-4,4-diethoxybutyl)benzene has a molecular weight of 358.42 g/mol, XLogP of 4.65, 13 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-diethoxyphosphoryl-4,4-diethoxybutyl)benzene is sourced from PubChem (CID 2773701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).