C15H21BO5 — CID 2773975
[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] acetate (PubChem CID 2773975) has the molecular formula C15H21BO5 and a molecular weight of 292.14 g/mol. Its IUPAC name is [2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] acetate.
| Compound Name | [2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] acetate |
|---|---|
| PubChem CID | 2773975 |
| Molecular Formula | C15H21BO5 |
| Molecular Weight | 292.14 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | [2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] acetate |
| SMILES | COc1cc(B2OC(C)(C)C(C)(C)O2)ccc1OC(C)=O |
| InChI | InChI=1S/C15H21BO5/c1-10(17)19-12-8-7-11(9-13(12)18-6)16-20-14(2,3)15(4,5)21-16/h7-9H,1-6H3 |
| InChIKey | SQWMSVLBTLTANH-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.14 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|