About 2,4-dibromo-6-fluorophenol
2,4-dibromo-6-fluorophenol (PubChem CID 2773980) has the molecular formula C6H3Br2FO
and a molecular weight of 269.89 g/mol. Its IUPAC name is 2,4-dibromo-6-fluorophenol.
Molecular Properties
| Compound Name | 2,4-dibromo-6-fluorophenol |
| PubChem CID | 2773980 |
| Molecular Formula | C6H3Br2FO |
| Molecular Weight | 269.89 g/mol |
| Exact Mass | 267.85 |
| IUPAC Name | 2,4-dibromo-6-fluorophenol |
| SMILES | Oc1c(F)cc(Br)cc1Br |
| InChI | InChI=1S/C6H3Br2FO/c7-3-1-4(8)6(10)5(9)2-3/h1-2,10H |
| InChIKey | XJDJZAUITWTZAS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.89 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,4-dibromo-6-fluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dibromo-6-fluorophenol?
The IUPAC name of 2,4-dibromo-6-fluorophenol (CID 2773980) is 2,4-dibromo-6-fluorophenol.
What is the SMILES notation for 2,4-dibromo-6-fluorophenol?
The canonical SMILES for 2,4-dibromo-6-fluorophenol is Oc1c(F)cc(Br)cc1Br.
What is the InChIKey of 2,4-dibromo-6-fluorophenol?
The InChIKey is XJDJZAUITWTZAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3Br2FO/c7-3-1-4(8)6(10)5(9)2-3/h1-2,10H.
What are the key properties of 2,4-dibromo-6-fluorophenol?
2,4-dibromo-6-fluorophenol has a molecular weight of 269.89 g/mol, XLogP of 3.06, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dibromo-6-fluorophenol is sourced from PubChem (CID 2773980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).