About 6-hydroxy-3,4-dihydro-1H-quinolin-2-one
6-hydroxy-3,4-dihydro-1H-quinolin-2-one (PubChem CID 2774040) has the molecular formula C9H9NO2
and a molecular weight of 163.18 g/mol. Its IUPAC name is 6-hydroxy-3,4-dihydro-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 6-hydroxy-3,4-dihydro-1H-quinolin-2-one |
| PubChem CID | 2774040 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 6-hydroxy-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(O)ccc2N1 |
| InChI | InChI=1S/C9H9NO2/c11-7-2-3-8-6(5-7)1-4-9(12)10-8/h2-3,5,11H,1,4H2,(H,10,12) |
| InChIKey | HOSGXJWQVBHGLT-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroxy-3,4-dihydro-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-3,4-dihydro-1H-quinolin-2-one?
The IUPAC name of 6-hydroxy-3,4-dihydro-1H-quinolin-2-one (CID 2774040) is 6-hydroxy-3,4-dihydro-1H-quinolin-2-one.
What is the SMILES notation for 6-hydroxy-3,4-dihydro-1H-quinolin-2-one?
The canonical SMILES for 6-hydroxy-3,4-dihydro-1H-quinolin-2-one is O=C1CCc2cc(O)ccc2N1.
What is the InChIKey of 6-hydroxy-3,4-dihydro-1H-quinolin-2-one?
The InChIKey is HOSGXJWQVBHGLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2/c11-7-2-3-8-6(5-7)1-4-9(12)10-8/h2-3,5,11H,1,4H2,(H,10,12).
What are the key properties of 6-hydroxy-3,4-dihydro-1H-quinolin-2-one?
6-hydroxy-3,4-dihydro-1H-quinolin-2-one has a molecular weight of 163.18 g/mol, XLogP of 1.28, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-3,4-dihydro-1H-quinolin-2-one is sourced from PubChem (CID 2774040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).