C26H12Cl6O4S — CID 2774295
[4-chloro-2-[5-chloro-2-(2,6-dichlorobenzoyl)oxyphenyl]sulfanylphenyl] 2,6-dichlorobenzoate (PubChem CID 2774295) has the molecular formula C26H12Cl6O4S and a molecular weight of 633.16 g/mol. Its IUPAC name is [4-chloro-2-[5-chloro-2-(2,6-dichlorobenzoyl)oxyphenyl]sulfanylphenyl] 2,6-dichlorobenzoate.
| Compound Name | [4-chloro-2-[5-chloro-2-(2,6-dichlorobenzoyl)oxyphenyl]sulfanylphenyl] 2,6-dichlorobenzoate |
|---|---|
| PubChem CID | 2774295 |
| Molecular Formula | C26H12Cl6O4S |
| Molecular Weight | 633.16 g/mol |
| Exact Mass | 629.86 |
| IUPAC Name | [4-chloro-2-[5-chloro-2-(2,6-dichlorobenzoyl)oxyphenyl]sulfanylphenyl] 2,6-dichlorobenzoate |
| SMILES | O=C(Oc1ccc(Cl)cc1Sc1cc(Cl)ccc1OC(=O)c1c(Cl)cccc1Cl)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C26H12Cl6O4S/c27-13-7-9-19(35-25(33)23-15(29)3-1-4-16(23)30)21(11-13)37-22-12-14(28)8-10-20(22)36-26(34)24-17(31)5-2-6-18(24)32/h1-12H |
| InChIKey | YSANEKFHZYZNII-UHFFFAOYSA-N |
| XLogP | 10.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.16 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|