C10H9ClF3NO2S — CID 2774344
ethyl 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetate (PubChem CID 2774344) has the molecular formula C10H9ClF3NO2S and a molecular weight of 299.70 g/mol. Its IUPAC name is ethyl 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetate |
|---|---|
| PubChem CID | 2774344 |
| Molecular Formula | C10H9ClF3NO2S |
| Molecular Weight | 299.70 g/mol |
| Exact Mass | 299.00 |
| IUPAC Name | ethyl 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C10H9ClF3NO2S/c1-2-17-8(16)5-18-9-7(11)3-6(4-15-9)10(12,13)14/h3-4H,2,5H2,1H3 |
| InChIKey | UDKFFMRSQQNXBU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.70 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |