About 4-fluoro-N-phenylaniline
4-fluoro-N-phenylaniline (PubChem CID 2774468) has the molecular formula C12H10FN
and a molecular weight of 187.22 g/mol. Its IUPAC name is 4-fluoro-N-phenylaniline.
Molecular Properties
| Compound Name | 4-fluoro-N-phenylaniline |
| PubChem CID | 2774468 |
| Molecular Formula | C12H10FN |
| Molecular Weight | 187.22 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 4-fluoro-N-phenylaniline |
| SMILES | Fc1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10FN/c13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11/h1-9,14H |
| InChIKey | RBWCFTJQRDTIBX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.22 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-fluoro-N-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-N-phenylaniline?
The IUPAC name of 4-fluoro-N-phenylaniline (CID 2774468) is 4-fluoro-N-phenylaniline.
What is the SMILES notation for 4-fluoro-N-phenylaniline?
The canonical SMILES for 4-fluoro-N-phenylaniline is Fc1ccc(Nc2ccccc2)cc1.
What is the InChIKey of 4-fluoro-N-phenylaniline?
The InChIKey is RBWCFTJQRDTIBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10FN/c13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11/h1-9,14H.
What are the key properties of 4-fluoro-N-phenylaniline?
4-fluoro-N-phenylaniline has a molecular weight of 187.22 g/mol, XLogP of 3.57, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-N-phenylaniline is sourced from PubChem (CID 2774468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).