C21H24ClN3O3S — CID 27744729
methyl 6-[[1-[(2-chlorophenyl)methyl]-3-methylthieno[3,2-d]pyrazole-5-carbonyl]amino]hexanoate (PubChem CID 27744729) has the molecular formula C21H24ClN3O3S and a molecular weight of 433.96 g/mol. Its IUPAC name is methyl 6-[[1-[(2-chlorophenyl)methyl]-3-methylthieno[3,2-d]pyrazole-5-carbonyl]amino]hexanoate.
| Compound Name | methyl 6-[[1-[(2-chlorophenyl)methyl]-3-methylthieno[3,2-d]pyrazole-5-carbonyl]amino]hexanoate |
|---|---|
| PubChem CID | 27744729 |
| Molecular Formula | C21H24ClN3O3S |
| Molecular Weight | 433.96 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | methyl 6-[[1-[(2-chlorophenyl)methyl]-3-methylthieno[3,2-d]pyrazole-5-carbonyl]amino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)c1cc2c(C)nn(Cc3ccccc3Cl)c2s1 |
| InChI | InChI=1S/C21H24ClN3O3S/c1-14-16-12-18(20(27)23-11-7-3-4-10-19(26)28-2)29-21(16)25(24-14)13-15-8-5-6-9-17(15)22/h5-6,8-9,12H,3-4,7,10-11,13H2,1-2H3,(H,23,27) |
| InChIKey | KTDSNCYJVHABAS-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.96 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|