C11H12N2O3S — CID 27745078
(2S)-N-methoxy-2-methyl-3-oxo-4H-1,4-benzothiazine-6-carboxamide (PubChem CID 27745078) has the molecular formula C11H12N2O3S and a molecular weight of 252.29 g/mol. Its IUPAC name is (2S)-N-methoxy-2-methyl-3-oxo-4H-1,4-benzothiazine-6-carboxamide.
| Compound Name | (2S)-N-methoxy-2-methyl-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 27745078 |
| Molecular Formula | C11H12N2O3S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | (2S)-N-methoxy-2-methyl-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
| SMILES | CONC(=O)c1ccc2c(c1)NC(=O)[C@H](C)S2 |
| InChI | InChI=1S/C11H12N2O3S/c1-6-10(14)12-8-5-7(11(15)13-16-2)3-4-9(8)17-6/h3-6H,1-2H3,(H,12,14)(H,13,15)/t6-/m0/s1 |
| InChIKey | NMAUIGOAARQNBD-LURJTMIESA-N |
| XLogP | 1.41 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|