C13H8ClN3O — CID 2774636
(6-chloroimidazo[1,2-b]pyridazin-3-yl)-phenylmethanone (PubChem CID 2774636) has the molecular formula C13H8ClN3O and a molecular weight of 257.68 g/mol. Its IUPAC name is (6-chloroimidazo[1,2-b]pyridazin-3-yl)-phenylmethanone.
| Compound Name | (6-chloroimidazo[1,2-b]pyridazin-3-yl)-phenylmethanone |
|---|---|
| PubChem CID | 2774636 |
| Molecular Formula | C13H8ClN3O |
| Molecular Weight | 257.68 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | (6-chloroimidazo[1,2-b]pyridazin-3-yl)-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1cnc2ccc(Cl)nn12 |
| InChI | InChI=1S/C13H8ClN3O/c14-11-6-7-12-15-8-10(17(12)16-11)13(18)9-4-2-1-3-5-9/h1-8H |
| InChIKey | DWEXNPGMMTWOKC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.68 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |