C26H28N4O2S2 — CID 27746871
(2R)-N-[3-(N-methylanilino)propyl]-2-[(4-oxo-5-phenyl-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]propanamide (PubChem CID 27746871) has the molecular formula C26H28N4O2S2 and a molecular weight of 492.67 g/mol. Its IUPAC name is (2R)-N-[3-(N-methylanilino)propyl]-2-[(4-oxo-5-phenyl-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]propanamide.
| Compound Name | (2R)-N-[3-(N-methylanilino)propyl]-2-[(4-oxo-5-phenyl-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]propanamide |
|---|---|
| PubChem CID | 27746871 |
| Molecular Formula | C26H28N4O2S2 |
| Molecular Weight | 492.67 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | (2R)-N-[3-(N-methylanilino)propyl]-2-[(4-oxo-5-phenyl-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]propanamide |
| SMILES | C[C@@H](SCc1nc2scc(-c3ccccc3)c2c(=O)[nH]1)C(=O)NCCCN(C)c1ccccc1 |
| InChI | InChI=1S/C26H28N4O2S2/c1-18(24(31)27-14-9-15-30(2)20-12-7-4-8-13-20)33-17-22-28-25(32)23-21(16-34-26(23)29-22)19-10-5-3-6-11-19/h3-8,10-13,16,18H,9,14-15,17H2,1-2H3,(H,27,31)(H,28,29,32)/t18-/m1/s1 |
| InChIKey | RJPHLPDWIWSLFF-GOSISDBHSA-N |
| XLogP | 4.92 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.67 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|