About 1,4-dihydropyrazine-2,3-dione
1,4-dihydropyrazine-2,3-dione (PubChem CID 2774693) has the molecular formula C4H4N2O2
and a molecular weight of 112.09 g/mol. Its IUPAC name is 1,4-dihydropyrazine-2,3-dione.
Molecular Properties
| Compound Name | 1,4-dihydropyrazine-2,3-dione |
| PubChem CID | 2774693 |
| Molecular Formula | C4H4N2O2 |
| Molecular Weight | 112.09 g/mol |
| Exact Mass | 112.03 |
| IUPAC Name | 1,4-dihydropyrazine-2,3-dione |
| SMILES | O=c1[nH]cc[nH]c1=O |
| InChI | InChI=1S/C4H4N2O2/c7-3-4(8)6-2-1-5-3/h1-2H,(H,5,7)(H,6,8) |
| InChIKey | CIGLZLCKRXOFQU-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.09 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dihydropyrazine-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dihydropyrazine-2,3-dione?
The IUPAC name of 1,4-dihydropyrazine-2,3-dione (CID 2774693) is 1,4-dihydropyrazine-2,3-dione.
What is the SMILES notation for 1,4-dihydropyrazine-2,3-dione?
The canonical SMILES for 1,4-dihydropyrazine-2,3-dione is O=c1[nH]cc[nH]c1=O.
What is the InChIKey of 1,4-dihydropyrazine-2,3-dione?
The InChIKey is CIGLZLCKRXOFQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N2O2/c7-3-4(8)6-2-1-5-3/h1-2H,(H,5,7)(H,6,8).
What are the key properties of 1,4-dihydropyrazine-2,3-dione?
1,4-dihydropyrazine-2,3-dione has a molecular weight of 112.09 g/mol, XLogP of -0.94, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dihydropyrazine-2,3-dione is sourced from PubChem (CID 2774693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).