C10H5FN4O2 — CID 2774699
2-(4-fluorophenyl)-3,5-dioxo-1,2,4-triazine-6-carbonitrile (PubChem CID 2774699) has the molecular formula C10H5FN4O2 and a molecular weight of 232.17 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-3,5-dioxo-1,2,4-triazine-6-carbonitrile.
| Compound Name | 2-(4-fluorophenyl)-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
|---|---|
| PubChem CID | 2774699 |
| Molecular Formula | C10H5FN4O2 |
| Molecular Weight | 232.17 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | 2-(4-fluorophenyl)-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
| SMILES | N#Cc1nn(-c2ccc(F)cc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H5FN4O2/c11-6-1-3-7(4-2-6)15-10(17)13-9(16)8(5-12)14-15/h1-4H,(H,13,16,17) |
| InChIKey | ISWRTNVTUXQOIZ-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 91.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.17 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |