About 3-bromo-2,6-dimethoxybenzoic acid
3-bromo-2,6-dimethoxybenzoic acid (PubChem CID 2774744) has the molecular formula C9H9BrO4
and a molecular weight of 261.07 g/mol. Its IUPAC name is 3-bromo-2,6-dimethoxybenzoic acid.
Molecular Properties
| Compound Name | 3-bromo-2,6-dimethoxybenzoic acid |
| PubChem CID | 2774744 |
| Molecular Formula | C9H9BrO4 |
| Molecular Weight | 261.07 g/mol |
| Exact Mass | 259.97 |
| IUPAC Name | 3-bromo-2,6-dimethoxybenzoic acid |
| SMILES | COc1ccc(Br)c(OC)c1C(=O)O |
| InChI | InChI=1S/C9H9BrO4/c1-13-6-4-3-5(10)8(14-2)7(6)9(11)12/h3-4H,1-2H3,(H,11,12) |
| InChIKey | CUQANLQRQJHIQE-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.07 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-bromo-2,6-dimethoxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2,6-dimethoxybenzoic acid?
The IUPAC name of 3-bromo-2,6-dimethoxybenzoic acid (CID 2774744) is 3-bromo-2,6-dimethoxybenzoic acid.
What is the SMILES notation for 3-bromo-2,6-dimethoxybenzoic acid?
The canonical SMILES for 3-bromo-2,6-dimethoxybenzoic acid is COc1ccc(Br)c(OC)c1C(=O)O.
What is the InChIKey of 3-bromo-2,6-dimethoxybenzoic acid?
The InChIKey is CUQANLQRQJHIQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrO4/c1-13-6-4-3-5(10)8(14-2)7(6)9(11)12/h3-4H,1-2H3,(H,11,12).
What are the key properties of 3-bromo-2,6-dimethoxybenzoic acid?
3-bromo-2,6-dimethoxybenzoic acid has a molecular weight of 261.07 g/mol, XLogP of 2.16, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2,6-dimethoxybenzoic acid is sourced from PubChem (CID 2774744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).