About 4,5-dichloro-2-(2,4-dichlorophenyl)pyridazin-3-one
4,5-dichloro-2-(2,4-dichlorophenyl)pyridazin-3-one (PubChem CID 2774866) has the molecular formula C10H4Cl4N2O
and a molecular weight of 309.97 g/mol. Its IUPAC name is 4,5-dichloro-2-(2,4-dichlorophenyl)pyridazin-3-one.
Molecular Properties
| Compound Name | 4,5-dichloro-2-(2,4-dichlorophenyl)pyridazin-3-one |
| PubChem CID | 2774866 |
| Molecular Formula | C10H4Cl4N2O |
| Molecular Weight | 309.97 g/mol |
| Exact Mass | 307.91 |
| IUPAC Name | 4,5-dichloro-2-(2,4-dichlorophenyl)pyridazin-3-one |
| SMILES | O=c1c(Cl)c(Cl)cnn1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H4Cl4N2O/c11-5-1-2-8(6(12)3-5)16-10(17)9(14)7(13)4-15-16/h1-4H |
| InChIKey | MBOSIQQMKNDSDJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.97 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,5-dichloro-2-(2,4-dichlorophenyl)pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dichloro-2-(2,4-dichlorophenyl)pyridazin-3-one?
The IUPAC name of 4,5-dichloro-2-(2,4-dichlorophenyl)pyridazin-3-one (CID 2774866) is 4,5-dichloro-2-(2,4-dichlorophenyl)pyridazin-3-one.
What is the SMILES notation for 4,5-dichloro-2-(2,4-dichlorophenyl)pyridazin-3-one?
The canonical SMILES for 4,5-dichloro-2-(2,4-dichlorophenyl)pyridazin-3-one is O=c1c(Cl)c(Cl)cnn1-c1ccc(Cl)cc1Cl.
What is the InChIKey of 4,5-dichloro-2-(2,4-dichlorophenyl)pyridazin-3-one?
The InChIKey is MBOSIQQMKNDSDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H4Cl4N2O/c11-5-1-2-8(6(12)3-5)16-10(17)9(14)7(13)4-15-16/h1-4H.
What are the key properties of 4,5-dichloro-2-(2,4-dichlorophenyl)pyridazin-3-one?
4,5-dichloro-2-(2,4-dichlorophenyl)pyridazin-3-one has a molecular weight of 309.97 g/mol, XLogP of 3.85, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dichloro-2-(2,4-dichlorophenyl)pyridazin-3-one is sourced from PubChem (CID 2774866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).