C18H8Cl6O4 — CID 2774873
[3-phenyl-4-(2,3,3-trichloroprop-2-enoyloxy)phenyl] 2,3,3-trichloroprop-2-enoate (PubChem CID 2774873) has the molecular formula C18H8Cl6O4 and a molecular weight of 500.98 g/mol. Its IUPAC name is [3-phenyl-4-(2,3,3-trichloroprop-2-enoyloxy)phenyl] 2,3,3-trichloroprop-2-enoate.
| Compound Name | [3-phenyl-4-(2,3,3-trichloroprop-2-enoyloxy)phenyl] 2,3,3-trichloroprop-2-enoate |
|---|---|
| PubChem CID | 2774873 |
| Molecular Formula | C18H8Cl6O4 |
| Molecular Weight | 500.98 g/mol |
| Exact Mass | 497.86 |
| IUPAC Name | [3-phenyl-4-(2,3,3-trichloroprop-2-enoyloxy)phenyl] 2,3,3-trichloroprop-2-enoate |
| SMILES | O=C(Oc1ccc(OC(=O)C(Cl)=C(Cl)Cl)c(-c2ccccc2)c1)C(Cl)=C(Cl)Cl |
| InChI | InChI=1S/C18H8Cl6O4/c19-13(15(21)22)17(25)27-10-6-7-12(28-18(26)14(20)16(23)24)11(8-10)9-4-2-1-3-5-9/h1-8H |
| InChIKey | OHWGEHLMZYKLFP-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.98 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|