C8H8F7NO — CID 2774888
N-(2,2,3,3,4,4,4-heptafluorobutyl)-2-methylprop-2-enamide (PubChem CID 2774888) has the molecular formula C8H8F7NO and a molecular weight of 267.14 g/mol. Its IUPAC name is N-(2,2,3,3,4,4,4-heptafluorobutyl)-2-methylprop-2-enamide.
| Compound Name | N-(2,2,3,3,4,4,4-heptafluorobutyl)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 2774888 |
| Molecular Formula | C8H8F7NO |
| Molecular Weight | 267.14 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | N-(2,2,3,3,4,4,4-heptafluorobutyl)-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H8F7NO/c1-4(2)5(17)16-3-6(9,10)7(11,12)8(13,14)15/h1,3H2,2H3,(H,16,17) |
| InChIKey | MIKFERZOWUQQSR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.14 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|