C6H5F7 — CID 2774912
4,4,5,5,6,6,6-heptafluorohex-2-ene (PubChem CID 2774912) has the molecular formula C6H5F7 and a molecular weight of 210.09 g/mol. Its IUPAC name is 4,4,5,5,6,6,6-heptafluorohex-2-ene.
| Compound Name | 4,4,5,5,6,6,6-heptafluorohex-2-ene |
|---|---|
| PubChem CID | 2774912 |
| Molecular Formula | C6H5F7 |
| Molecular Weight | 210.09 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | 4,4,5,5,6,6,6-heptafluorohex-2-ene |
| SMILES | CC=CC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H5F7/c1-2-3-4(7,8)5(9,10)6(11,12)13/h2-3H,1H3 |
| InChIKey | HVOUHYGSLBPLGT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.09 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|