C18H18N2O7S — CID 27749168
[2-(2-methyl-3-nitroanilino)-2-oxoethyl] 3-(methylsulfonylmethyl)benzoate (PubChem CID 27749168) has the molecular formula C18H18N2O7S and a molecular weight of 406.42 g/mol. Its IUPAC name is [2-(2-methyl-3-nitroanilino)-2-oxoethyl] 3-(methylsulfonylmethyl)benzoate.
| Compound Name | [2-(2-methyl-3-nitroanilino)-2-oxoethyl] 3-(methylsulfonylmethyl)benzoate |
|---|---|
| PubChem CID | 27749168 |
| Molecular Formula | C18H18N2O7S |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | [2-(2-methyl-3-nitroanilino)-2-oxoethyl] 3-(methylsulfonylmethyl)benzoate |
| SMILES | Cc1c(NC(=O)COC(=O)c2cccc(CS(C)(=O)=O)c2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H18N2O7S/c1-12-15(7-4-8-16(12)20(23)24)19-17(21)10-27-18(22)14-6-3-5-13(9-14)11-28(2,25)26/h3-9H,10-11H2,1-2H3,(H,19,21) |
| InChIKey | VXAJCVNPPFJFCR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|