C9H10F7I — CID 2774923
1-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-iodocyclohexane (PubChem CID 2774923) has the molecular formula C9H10F7I and a molecular weight of 378.07 g/mol. Its IUPAC name is 1-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-iodocyclohexane.
| Compound Name | 1-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-iodocyclohexane |
|---|---|
| PubChem CID | 2774923 |
| Molecular Formula | C9H10F7I |
| Molecular Weight | 378.07 g/mol |
| Exact Mass | 377.97 |
| IUPAC Name | 1-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-iodocyclohexane |
| SMILES | FC(F)(F)C(F)(C1CCCCC1I)C(F)(F)F |
| InChI | InChI=1S/C9H10F7I/c10-7(8(11,12)13,9(14,15)16)5-3-1-2-4-6(5)17/h5-6H,1-4H2 |
| InChIKey | MPDWEHWICQEPCD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.07 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|