C7H5F7N2 — CID 2774945
3-(1,1,2,2,3,3,3-heptafluoropropyl)-5-methyl-1H-pyrazole (PubChem CID 2774945) has the molecular formula C7H5F7N2 and a molecular weight of 250.12 g/mol. Its IUPAC name is 3-(1,1,2,2,3,3,3-heptafluoropropyl)-5-methyl-1H-pyrazole.
| Compound Name | 3-(1,1,2,2,3,3,3-heptafluoropropyl)-5-methyl-1H-pyrazole |
|---|---|
| PubChem CID | 2774945 |
| Molecular Formula | C7H5F7N2 |
| Molecular Weight | 250.12 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 3-(1,1,2,2,3,3,3-heptafluoropropyl)-5-methyl-1H-pyrazole |
| SMILES | Cc1cc(C(F)(F)C(F)(F)C(F)(F)F)n[nH]1 |
| InChI | InChI=1S/C7H5F7N2/c1-3-2-4(16-15-3)5(8,9)6(10,11)7(12,13)14/h2H,1H3,(H,15,16) |
| InChIKey | HGKNTSQKMGECCF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.12 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|