C7H6F6O2 — CID 2774977
2,2,3,4,4,4-hexafluorobutyl prop-2-enoate (PubChem CID 2774977) has the molecular formula C7H6F6O2 and a molecular weight of 236.11 g/mol. Its IUPAC name is 2,2,3,4,4,4-hexafluorobutyl prop-2-enoate.
| Compound Name | 2,2,3,4,4,4-hexafluorobutyl prop-2-enoate |
|---|---|
| PubChem CID | 2774977 |
| Molecular Formula | C7H6F6O2 |
| Molecular Weight | 236.11 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | 2,2,3,4,4,4-hexafluorobutyl prop-2-enoate |
| SMILES | C=CC(=O)OCC(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C7H6F6O2/c1-2-4(14)15-3-6(9,10)5(8)7(11,12)13/h2,5H,1,3H2 |
| InChIKey | LMVLEDTVXAGBJV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.11 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|